C19H27ClN4O9P2 — CID 167337610
[[(2R,3S,4R,5S)-5-[8-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167337610) has the molecular formula C19H27ClN4O9P2 and a molecular weight of 552.85 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[8-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[8-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167337610 |
| Molecular Formula | C19H27ClN4O9P2 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[8-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-chloroimidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2cnc3c(N4CC5CCCC5C4)cc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H27ClN4O9P2/c20-15-4-12(23-6-10-2-1-3-11(10)7-23)19-21-5-13(24(19)22-15)18-17(26)16(25)14(33-18)8-32-35(30,31)9-34(27,28)29/h4-5,10-11,14,16-18,25-26H,1-3,6-9H2,(H,30,31)(H2,27,28,29)/t10?,11?,14-,16-,17-,18+/m1/s1 |
| InChIKey | CFTLJOVFQLRXEE-KLJRHFIGSA-N |
| XLogP | 1.12 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|