C20H23ClN4O9P2 — CID 167337608
[[(2R,3S,4R,5S)-5-[6-chloro-8-(1,3-dihydroisoindol-2-yl)imidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167337608) has the molecular formula C20H23ClN4O9P2 and a molecular weight of 560.82 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[6-chloro-8-(1,3-dihydroisoindol-2-yl)imidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[6-chloro-8-(1,3-dihydroisoindol-2-yl)imidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167337608 |
| Molecular Formula | C20H23ClN4O9P2 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[6-chloro-8-(1,3-dihydroisoindol-2-yl)imidazo[1,2-b]pyridazin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2cnc3c(N4Cc5ccccc5C4)cc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H23ClN4O9P2/c21-16-5-13(24-7-11-3-1-2-4-12(11)8-24)20-22-6-14(25(20)23-16)19-18(27)17(26)15(34-19)9-33-36(31,32)10-35(28,29)30/h1-6,15,17-19,26-27H,7-10H2,(H,31,32)(H2,28,29,30)/t15-,17-,18-,19+/m1/s1 |
| InChIKey | WSAODBTXWAYJDQ-OWYHZJEWSA-N |
| XLogP | 1.40 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|