C17H24ClN3O10P2 — CID 165176223
[[(2R,3S,4R)-5-(6-chloro-8-cyclopentyloxyimidazo[1,2-b]pyridazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 165176223) has the molecular formula C17H24ClN3O10P2 and a molecular weight of 527.79 g/mol. Its IUPAC name is [[(2R,3S,4R)-5-(6-chloro-8-cyclopentyloxyimidazo[1,2-b]pyridazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R)-5-(6-chloro-8-cyclopentyloxyimidazo[1,2-b]pyridazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 165176223 |
| Molecular Formula | C17H24ClN3O10P2 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | [[(2R,3S,4R)-5-(6-chloro-8-cyclopentyloxyimidazo[1,2-b]pyridazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1OC(c2cnc3c(OC4CCCC4)cc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24ClN3O10P2/c18-13-5-11(30-9-3-1-2-4-9)17-19-6-10(21(17)20-13)16-15(23)14(22)12(31-16)7-29-33(27,28)8-32(24,25)26/h5-6,9,12,14-16,22-23H,1-4,7-8H2,(H,27,28)(H2,24,25,26)/t12-,14-,15-,16?/m1/s1 |
| InChIKey | ZAJYMDRUHZIODJ-KCMBKRDQSA-N |
| XLogP | 1.20 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|