C18H27ClN4O9P2 — CID 139481662
[[(3R,4R,5R,6R)-6-[6-chloro-4-(cyclopentylamino)imidazo[4,5-c]pyridin-1-yl]-4,5-dihydroxyoxan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 139481662) has the molecular formula C18H27ClN4O9P2 and a molecular weight of 540.83 g/mol. Its IUPAC name is [[(3R,4R,5R,6R)-6-[6-chloro-4-(cyclopentylamino)imidazo[4,5-c]pyridin-1-yl]-4,5-dihydroxyoxan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(3R,4R,5R,6R)-6-[6-chloro-4-(cyclopentylamino)imidazo[4,5-c]pyridin-1-yl]-4,5-dihydroxyoxan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 139481662 |
| Molecular Formula | C18H27ClN4O9P2 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | [[(3R,4R,5R,6R)-6-[6-chloro-4-(cyclopentylamino)imidazo[4,5-c]pyridin-1-yl]-4,5-dihydroxyoxan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1CO[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)cc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27ClN4O9P2/c19-13-5-12-14(17(22-13)21-11-3-1-2-4-11)20-8-23(12)18-16(25)15(24)10(6-31-18)7-32-34(29,30)9-33(26,27)28/h5,8,10-11,15-16,18,24-25H,1-4,6-7,9H2,(H,21,22)(H,29,30)(H2,26,27,28)/t10-,15-,16-,18-/m1/s1 |
| InChIKey | IVENBTSNOLWJGZ-DUBJGWMJSA-N |
| XLogP | 1.64 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|