C15H20ClN5O4 — CID 155228153
(3R,4S)-2-[2-chloro-4-(cyclopentylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 155228153) has the molecular formula C15H20ClN5O4 and a molecular weight of 369.81 g/mol. Its IUPAC name is (3R,4S)-2-[2-chloro-4-(cyclopentylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S)-2-[2-chloro-4-(cyclopentylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155228153 |
| Molecular Formula | C15H20ClN5O4 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3R,4S)-2-[2-chloro-4-(cyclopentylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OCC1OC(c2cnc3c(NC4CCCC4)nc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H20ClN5O4/c16-15-19-13(18-7-3-1-2-4-7)14-17-5-8(21(14)20-15)12-11(24)10(23)9(6-22)25-12/h5,7,9-12,22-24H,1-4,6H2,(H,18,19,20)/t9?,10-,11-,12?/m1/s1 |
| InChIKey | JHYZOQJHURAWFH-BFUDSRACSA-N |
| XLogP | 0.29 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |