C16H21ClN4O4 — CID 165176206
(2S,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)imidazo[1,5-b]pyridazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 165176206) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)imidazo[1,5-b]pyridazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)imidazo[1,5-b]pyridazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 165176206 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2S,3R,4S,5R)-2-[2-chloro-4-(cyclopentylamino)imidazo[1,5-b]pyridazin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ncc3c(NC4CCCC4)cc(Cl)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21ClN4O4/c17-12-5-9(19-8-3-1-2-4-8)10-6-18-16(21(10)20-12)15-14(24)13(23)11(7-22)25-15/h5-6,8,11,13-15,19,22-24H,1-4,7H2/t11-,13-,14-,15-/m1/s1 |
| InChIKey | GGMZNKAKPUIRJU-NMFUWQPSSA-N |
| XLogP | 0.89 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |