C16H20ClFN4O3 — CID 162488766
(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[4,3-c]pyridin-1-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 162488766) has the molecular formula C16H20ClFN4O3 and a molecular weight of 370.81 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[4,3-c]pyridin-1-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[4,3-c]pyridin-1-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 162488766 |
| Molecular Formula | C16H20ClFN4O3 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[4,3-c]pyridin-1-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)cc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C16H20ClFN4O3/c17-12-5-10-9(15(21-12)20-8-3-1-2-4-8)6-19-22(10)16-13(18)14(24)11(7-23)25-16/h5-6,8,11,13-14,16,23-24H,1-4,7H2,(H,20,21)/t11-,13+,14-,16-/m1/s1 |
| InChIKey | LIRNQKHRNBLVMB-UZMCECQYSA-N |
| XLogP | 2.03 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|