C11H11Cl2N3O4 — CID 166124046
(2R,3R,4S,5R)-2-(4,6-dichloropyrazolo[5,4-b]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 166124046) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4,6-dichloropyrazolo[5,4-b]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4,6-dichloropyrazolo[5,4-b]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 166124046 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4,6-dichloropyrazolo[5,4-b]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2ncc3c(Cl)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H11Cl2N3O4/c12-5-1-7(13)15-10-4(5)2-14-16(10)11-9(19)8(18)6(3-17)20-11/h1-2,6,8-9,11,17-19H,3H2/t6-,8-,9-,11-/m1/s1 |
| InChIKey | NQAIHRXPEFNWLG-PNHWDRBUSA-N |
| XLogP | 0.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|