C19H19ClF6N4O4S — CID 162366651
(2R,3R,4S,5R)-2-[6-chloro-4-[[(1S)-1-[2-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 162366651) has the molecular formula C19H19ClF6N4O4S and a molecular weight of 548.89 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-chloro-4-[[(1S)-1-[2-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-chloro-4-[[(1S)-1-[2-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 162366651 |
| Molecular Formula | C19H19ClF6N4O4S |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-chloro-4-[[(1S)-1-[2-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C[C@H](Nc1cc(Cl)nc2c1cnn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)c1ccc(S(F)(F)(F)(F)F)cc1F |
| InChI | InChI=1S/C19H19ClF6N4O4S/c1-8(10-3-2-9(4-12(10)21)35(22,23,24,25)26)28-13-5-15(20)29-18-11(13)6-27-30(18)19-17(33)16(32)14(7-31)34-19/h2-6,8,14,16-17,19,31-33H,7H2,1H3,(H,28,29)/t8-,14+,16+,17+,19+/m0/s1 |
| InChIKey | QMANARJRGMFATD-WLGDHTAVSA-N |
| XLogP | 4.67 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|