C24H32ClN4O8P — CID 160960089
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methoxypropan-2-yl]phosphonic acid (PubChem CID 160960089) has the molecular formula C24H32ClN4O8P and a molecular weight of 570.97 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methoxypropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methoxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 160960089 |
| Molecular Formula | C24H32ClN4O8P |
| Molecular Weight | 570.97 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-methoxypropan-2-yl]phosphonic acid |
| SMILES | COCC(C)(OC[C@H]1O[C@@H](n2ncc3c(N[C@@H](C)c4ccc(C)cc4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C24H32ClN4O8P/c1-13-5-7-15(8-6-13)14(2)27-17-9-19(25)28-22-16(17)10-26-29(22)23-21(31)20(30)18(37-23)11-36-24(3,12-35-4)38(32,33)34/h5-10,14,18,20-21,23,30-31H,11-12H2,1-4H3,(H,27,28)(H2,32,33,34)/t14-,18+,20+,21+,23+,24?/m0/s1 |
| InChIKey | CLZNXQWVZLIXEG-VKJGUGNTSA-N |
| XLogP | 2.74 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.97 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|