C20H24ClFN5O7P — CID 171471701
aminooxy-[[(2R,3S,4R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid (PubChem CID 171471701) has the molecular formula C20H24ClFN5O7P and a molecular weight of 531.87 g/mol. Its IUPAC name is aminooxy-[[(2R,3S,4R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid.
| Compound Name | aminooxy-[[(2R,3S,4R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 171471701 |
| Molecular Formula | C20H24ClFN5O7P |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | aminooxy-[[(2R,3S,4R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid |
| SMILES | C[C@H](Nc1cc(Cl)nc2c1cnn2C1O[C@H](COCP(=O)(O)ON)[C@@H](O)[C@H]1O)c1ccccc1F |
| InChI | InChI=1S/C20H24ClFN5O7P/c1-10(11-4-2-3-5-13(11)22)25-14-6-16(21)26-19-12(14)7-24-27(19)20-18(29)17(28)15(33-20)8-32-9-35(30,31)34-23/h2-7,10,15,17-18,20,28-29H,8-9,23H2,1H3,(H,25,26)(H,30,31)/t10-,15+,17+,18+,20?/m0/s1 |
| InChIKey | PHTYQAPCSFFCAD-RJWBFHKOSA-N |
| XLogP | 2.07 |
| TPSA | 174.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|