C21H20ClFN4O4 — CID 174229536
(2R,3S,4R)-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 174229536) has the molecular formula C21H20ClFN4O4 and a molecular weight of 446.87 g/mol. Its IUPAC name is (2R,3S,4R)-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174229536 |
| Molecular Formula | C21H20ClFN4O4 |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (2R,3S,4R)-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@]1(CO)OC(n2ncc3c(NC(C)c4ccccc4F)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20ClFN4O4/c1-3-21(10-28)18(30)17(29)20(31-21)27-19-13(9-24-27)15(8-16(22)26-19)25-11(2)12-6-4-5-7-14(12)23/h1,4-9,11,17-18,20,28-30H,10H2,2H3,(H,25,26)/t11?,17-,18+,20?,21-/m1/s1 |
| InChIKey | HFFKIJGAFZCIKH-HROBANGUSA-N |
| XLogP | 2.01 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|