C16H22ClN5O4 — CID 167163196
(2R,3R,4S,5R)-2-[6-chloro-4-[(1-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 167163196) has the molecular formula C16H22ClN5O4 and a molecular weight of 383.84 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-chloro-4-[(1-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-chloro-4-[(1-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 167163196 |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-chloro-4-[(1-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC1(Nc2nc(Cl)nc3c2cnn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)CCCC1 |
| InChI | InChI=1S/C16H22ClN5O4/c1-16(4-2-3-5-16)21-12-8-6-18-22(13(8)20-15(17)19-12)14-11(25)10(24)9(7-23)26-14/h6,9-11,14,23-25H,2-5,7H2,1H3,(H,19,20,21)/t9-,10-,11-,14-/m1/s1 |
| InChIKey | MSNURSCSSBVHLA-ZHSDAYTOSA-N |
| XLogP | 0.84 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |