C14H10F10N4O4 — CID 102160309
(2R,3R,4S,5R)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 102160309) has the molecular formula C14H10F10N4O4 and a molecular weight of 488.24 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 102160309 |
| Molecular Formula | C14H10F10N4O4 |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4,6-bis(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2ncc3c(C(F)(F)C(F)(F)F)nc(C(F)(F)C(F)(F)F)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H10F10N4O4/c15-11(16,13(19,20)21)7-3-1-25-28(9-6(31)5(30)4(2-29)32-9)8(3)27-10(26-7)12(17,18)14(22,23)24/h1,4-6,9,29-31H,2H2/t4-,5-,6-,9-/m1/s1 |
| InChIKey | RUQGASXKTHMPEF-MWKIOEHESA-N |
| XLogP | 1.75 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|