C19H25ClN6O8P2 — CID 146496649
[[(1R,2R,3S,4R)-4-[5-chloro-7-[[(1S)-1-phenylethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 146496649) has the molecular formula C19H25ClN6O8P2 and a molecular weight of 562.84 g/mol. Its IUPAC name is [[(1R,2R,3S,4R)-4-[5-chloro-7-[[(1S)-1-phenylethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,2R,3S,4R)-4-[5-chloro-7-[[(1S)-1-phenylethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 146496649 |
| Molecular Formula | C19H25ClN6O8P2 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | [[(1R,2R,3S,4R)-4-[5-chloro-7-[[(1S)-1-phenylethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1nnn2[C@@H]1C[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H25ClN6O8P2/c1-10(11-5-3-2-4-6-11)21-17-14-18(23-19(20)22-17)26(25-24-14)13-7-12(15(27)16(13)28)8-34-36(32,33)9-35(29,30)31/h2-6,10,12-13,15-16,27-28H,7-9H2,1H3,(H,32,33)(H,21,22,23)(H2,29,30,31)/t10-,12+,13+,15+,16-/m0/s1 |
| InChIKey | OQSVWRXWWOJOQG-LUYRDZSISA-N |
| XLogP | 1.67 |
| TPSA | 213.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|