C21H28ClN5O9P2 — CID 155444319
[[(2Z,3R,4R,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444319) has the molecular formula C21H28ClN5O9P2 and a molecular weight of 591.88 g/mol. Its IUPAC name is [[(2Z,3R,4R,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2Z,3R,4R,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444319 |
| Molecular Formula | C21H28ClN5O9P2 |
| Molecular Weight | 591.88 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | [[(2Z,3R,4R,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H](O)n1ncc2c(N[C@@H](C)c3ccccc3)nc(Cl)nc21 |
| InChI | InChI=1S/C21H28ClN5O9P2/c1-3-13(10-36-38(34,35)11-37(31,32)33)16(28)17(29)20(30)27-19-15(9-23-27)18(25-21(22)26-19)24-12(2)14-7-5-4-6-8-14/h3-9,12,16-17,20,28-30H,10-11H2,1-2H3,(H,34,35)(H,24,25,26)(H2,31,32,33)/b13-3-/t12-,16+,17+,20+/m0/s1 |
| InChIKey | AVGJEQUQDKPLOR-BPLKAHLWSA-N |
| XLogP | 2.15 |
| TPSA | 220.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.88 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|