C24H34ClN5O9P2 — CID 155444477
[[(2Z,3R,4R,5R)-5-[6-[(4-tert-butylphenyl)methylamino]-2-chloropurin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444477) has the molecular formula C24H34ClN5O9P2 and a molecular weight of 633.96 g/mol. Its IUPAC name is [[(2Z,3R,4R,5R)-5-[6-[(4-tert-butylphenyl)methylamino]-2-chloropurin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2Z,3R,4R,5R)-5-[6-[(4-tert-butylphenyl)methylamino]-2-chloropurin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444477 |
| Molecular Formula | C24H34ClN5O9P2 |
| Molecular Weight | 633.96 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | [[(2Z,3R,4R,5R)-5-[6-[(4-tert-butylphenyl)methylamino]-2-chloropurin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H](O)n1cnc2c(NCc3ccc(C(C)(C)C)cc3)nc(Cl)nc21 |
| InChI | InChI=1S/C24H34ClN5O9P2/c1-5-15(11-39-41(37,38)13-40(34,35)36)18(31)19(32)22(33)30-12-27-17-20(28-23(25)29-21(17)30)26-10-14-6-8-16(9-7-14)24(2,3)4/h5-9,12,18-19,22,31-33H,10-11,13H2,1-4H3,(H,37,38)(H,26,28,29)(H2,34,35,36)/b15-5-/t18-,19-,22-/m1/s1 |
| InChIKey | JIEHXFJRHXYMHJ-LXPUYQMXSA-N |
| XLogP | 2.89 |
| TPSA | 220.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|