C20H29F4N5O8P2 — CID 155444316
[[(Z)-2-[(1R,2S,3R)-3-[6-(cyclopentylamino)-2-(trifluoromethyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444316) has the molecular formula C20H29F4N5O8P2 and a molecular weight of 605.42 g/mol. Its IUPAC name is [[(Z)-2-[(1R,2S,3R)-3-[6-(cyclopentylamino)-2-(trifluoromethyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(Z)-2-[(1R,2S,3R)-3-[6-(cyclopentylamino)-2-(trifluoromethyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444316 |
| Molecular Formula | C20H29F4N5O8P2 |
| Molecular Weight | 605.42 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | [[(Z)-2-[(1R,2S,3R)-3-[6-(cyclopentylamino)-2-(trifluoromethyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H](F)[C@@H](O)n1cnc2c(NC3CCCC3)nc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C20H29F4N5O8P2/c1-2-5-11(8-37-39(35,36)10-38(32,33)34)15(30)13(21)18(31)29-9-25-14-16(26-12-6-3-4-7-12)27-19(20(22,23)24)28-17(14)29/h5,9,12-13,15,18,30-31H,2-4,6-8,10H2,1H3,(H,35,36)(H,26,27,28)(H2,32,33,34)/b11-5-/t13-,15+,18+/m0/s1 |
| InChIKey | UNNACPICMLAYKL-DJOYAFMISA-N |
| XLogP | 3.06 |
| TPSA | 200.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|