C19H29ClFN5O9P2 — CID 155444358
[[(Z)-2-[(1R,2S,3R)-3-[2-chloro-6-(oxan-4-ylamino)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444358) has the molecular formula C19H29ClFN5O9P2 and a molecular weight of 587.87 g/mol. Its IUPAC name is [[(Z)-2-[(1R,2S,3R)-3-[2-chloro-6-(oxan-4-ylamino)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(Z)-2-[(1R,2S,3R)-3-[2-chloro-6-(oxan-4-ylamino)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444358 |
| Molecular Formula | C19H29ClFN5O9P2 |
| Molecular Weight | 587.87 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | [[(Z)-2-[(1R,2S,3R)-3-[2-chloro-6-(oxan-4-ylamino)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H](F)[C@@H](O)n1cnc2c(NC3CCOCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C19H29ClFN5O9P2/c1-2-3-11(8-35-37(32,33)10-36(29,30)31)15(27)13(21)18(28)26-9-22-14-16(24-19(20)25-17(14)26)23-12-4-6-34-7-5-12/h3,9,12-13,15,18,27-28H,2,4-8,10H2,1H3,(H,32,33)(H,23,24,25)(H2,29,30,31)/b11-3-/t13-,15+,18+/m0/s1 |
| InChIKey | OJTHONDSTXMTEV-SAXLHDLHSA-N |
| XLogP | 1.93 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|