C29H32FN5O8P2 — CID 155444519
[[(Z)-2-[(1R,2S,3R)-3-[6-(benzylamino)-2-(2-phenylethynyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444519) has the molecular formula C29H32FN5O8P2 and a molecular weight of 659.55 g/mol. Its IUPAC name is [[(Z)-2-[(1R,2S,3R)-3-[6-(benzylamino)-2-(2-phenylethynyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(Z)-2-[(1R,2S,3R)-3-[6-(benzylamino)-2-(2-phenylethynyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444519 |
| Molecular Formula | C29H32FN5O8P2 |
| Molecular Weight | 659.55 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | [[(Z)-2-[(1R,2S,3R)-3-[6-(benzylamino)-2-(2-phenylethynyl)purin-9-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H](F)[C@@H](O)n1cnc2c(NCc3ccccc3)nc(C#Cc3ccccc3)nc21 |
| InChI | InChI=1S/C29H32FN5O8P2/c1-2-9-22(17-43-45(41,42)19-44(38,39)40)26(36)24(30)29(37)35-18-32-25-27(31-16-21-12-7-4-8-13-21)33-23(34-28(25)35)15-14-20-10-5-3-6-11-20/h3-13,18,24,26,29,36-37H,2,16-17,19H2,1H3,(H,41,42)(H,31,33,34)(H2,38,39,40)/b22-9-/t24-,26+,29+/m0/s1 |
| InChIKey | IAFSWHLNAFIFNS-PIJVHHBOSA-N |
| XLogP | 3.70 |
| TPSA | 200.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|