C20H26BrN5O9P2 — CID 155444481
[[(2Z,3R,4R,5R)-5-[6-[(4-bromophenyl)methylamino]purin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444481) has the molecular formula C20H26BrN5O9P2 and a molecular weight of 622.31 g/mol. Its IUPAC name is [[(2Z,3R,4R,5R)-5-[6-[(4-bromophenyl)methylamino]purin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2Z,3R,4R,5R)-5-[6-[(4-bromophenyl)methylamino]purin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444481 |
| Molecular Formula | C20H26BrN5O9P2 |
| Molecular Weight | 622.31 g/mol |
| Exact Mass | 621.04 |
| IUPAC Name | [[(2Z,3R,4R,5R)-5-[6-[(4-bromophenyl)methylamino]purin-9-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H](O)n1cnc2c(NCc3ccc(Br)cc3)ncnc21 |
| InChI | InChI=1S/C20H26BrN5O9P2/c1-2-13(8-35-37(33,34)11-36(30,31)32)16(27)17(28)20(29)26-10-25-15-18(23-9-24-19(15)26)22-7-12-3-5-14(21)6-4-12/h2-6,9-10,16-17,20,27-29H,7-8,11H2,1H3,(H,33,34)(H,22,23,24)(H2,30,31,32)/b13-2-/t16-,17-,20-/m1/s1 |
| InChIKey | DXXOZCQLTXOHBS-USLHAXETSA-N |
| XLogP | 1.70 |
| TPSA | 220.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|