C19H29ClN4O9P2 — CID 155444326
[[(2Z,3R,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444326) has the molecular formula C19H29ClN4O9P2 and a molecular weight of 554.86 g/mol. Its IUPAC name is [[(2Z,3R,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2Z,3R,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444326 |
| Molecular Formula | C19H29ClN4O9P2 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | [[(2Z,3R,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-2-ethylidene-3,4,5-trihydroxypentoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H](O)n1ncc2c(NC3CCCC3)cc(Cl)nc21 |
| InChI | InChI=1S/C19H29ClN4O9P2/c1-2-11(9-33-35(31,32)10-34(28,29)30)16(25)17(26)19(27)24-18-13(8-21-24)14(7-15(20)23-18)22-12-5-3-4-6-12/h2,7-8,12,16-17,19,25-27H,3-6,9-10H2,1H3,(H,22,23)(H,31,32)(H2,28,29,30)/b11-2-/t16-,17-,19-/m1/s1 |
| InChIKey | VVUUVAHBPBTXOF-LSBHJGHFSA-N |
| XLogP | 1.94 |
| TPSA | 207.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|