C15H22ClN6O7P — CID 164819911
[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylmethylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 164819911) has the molecular formula C15H22ClN6O7P and a molecular weight of 464.80 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylmethylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylmethylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 164819911 |
| Molecular Formula | C15H22ClN6O7P |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylmethylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2nnc3c(NCC4CCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22ClN6O7P/c16-15-18-12(17-4-7-2-1-3-7)9-13(19-15)22(21-20-9)14-11(24)10(23)8(29-14)5-28-6-30(25,26)27/h7-8,10-11,14,23-24H,1-6H2,(H,17,18,19)(H2,25,26,27)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | APFNXBCZOVALAP-IDTAVKCVSA-N |
| XLogP | -0.14 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|