C17H26N5O7P — CID 153359151
[(2R,3S,4R,5R)-5-[7-(cyclopentylamino)-5-methyltriazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 153359151) has the molecular formula C17H26N5O7P and a molecular weight of 443.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[7-(cyclopentylamino)-5-methyltriazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[7-(cyclopentylamino)-5-methyltriazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 153359151 |
| Molecular Formula | C17H26N5O7P |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[7-(cyclopentylamino)-5-methyltriazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | Cc1cc(NC2CCCC2)c2nnn([C@@H]3O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C17H26N5O7P/c1-9-6-11(19-10-4-2-3-5-10)13-16(18-9)22(21-20-13)17-15(24)14(23)12(29-17)7-28-8-30(25,26)27/h6,10,12,14-15,17,23-24H,2-5,7-8H2,1H3,(H,18,19)(H2,25,26,27)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | WFDDTABHGPDILS-DNNBLBMLSA-N |
| XLogP | 0.26 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|