C19H24ClFN6O8P2 — CID 156682153
[[[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-(2-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylamino]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 156682153) has the molecular formula C19H24ClFN6O8P2 and a molecular weight of 580.83 g/mol. Its IUPAC name is [[[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-(2-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylamino]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-(2-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylamino]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 156682153 |
| Molecular Formula | C19H24ClFN6O8P2 |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | [[[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-(2-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylamino]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CNP(=O)(O)CP(=O)(O)O)C(O)[C@@H]1O)c1ccccc1F |
| InChI | InChI=1S/C19H24ClFN6O8P2/c1-9(10-4-2-3-5-11(10)21)24-16-13-17(26-19(20)25-16)27(7-22-13)18-15(29)14(28)12(35-18)6-23-36(30,31)8-37(32,33)34/h2-5,7,9,12,14-15,18,28-29H,6,8H2,1H3,(H2,23,30,31)(H,24,25,26)(H2,32,33,34)/t9-,12+,14?,15-,18+/m0/s1 |
| InChIKey | LNTORAKXMJMODU-KVKMSIROSA-N |
| XLogP | 1.32 |
| TPSA | 212.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|