C24H22ClN5O10P2 — CID 149065943
[[(2R,3R,4S,5R)-5-[2-chloro-6-[(9-oxofluoren-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 149065943) has the molecular formula C24H22ClN5O10P2 and a molecular weight of 637.87 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-[2-chloro-6-[(9-oxofluoren-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,4S,5R)-5-[2-chloro-6-[(9-oxofluoren-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 149065943 |
| Molecular Formula | C24H22ClN5O10P2 |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-[2-chloro-6-[(9-oxofluoren-3-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=C1c2ccccc2-c2cc(Nc3nc(Cl)nc4c3ncn4[C@@H]3O[C@H](COP(=O)(O)CP(=O)(O)O)[C@H](O)[C@@H]3O)ccc21 |
| InChI | InChI=1S/C24H22ClN5O10P2/c25-24-28-21(27-11-5-6-14-15(7-11)12-3-1-2-4-13(12)18(14)31)17-22(29-24)30(9-26-17)23-20(33)19(32)16(40-23)8-39-42(37,38)10-41(34,35)36/h1-7,9,16,19-20,23,32-33H,8,10H2,(H,37,38)(H,27,28,29)(H2,34,35,36)/t16-,19+,20+,23-/m1/s1 |
| InChIKey | QMVWIFFAVDZFJS-KNLNXMFASA-N |
| XLogP | 2.39 |
| TPSA | 226.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|