C17H26ClN5O11P2 — CID 153461313
[[(2R,3R,5R)-5-[2-chloro-6-(pentoxycarbonylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 153461313) has the molecular formula C17H26ClN5O11P2 and a molecular weight of 573.82 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[2-chloro-6-(pentoxycarbonylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,5R)-5-[2-chloro-6-(pentoxycarbonylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 153461313 |
| Molecular Formula | C17H26ClN5O11P2 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | [[(2R,3R,5R)-5-[2-chloro-6-(pentoxycarbonylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CCCCCOC(=O)Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@H](O)C1O |
| InChI | InChI=1S/C17H26ClN5O11P2/c1-2-3-4-5-32-17(26)21-13-10-14(22-16(18)20-13)23(7-19-10)15-12(25)11(24)9(34-15)6-33-36(30,31)8-35(27,28)29/h7,9,11-12,15,24-25H,2-6,8H2,1H3,(H,30,31)(H2,27,28,29)(H,20,21,22,26)/t9-,11+,12?,15-/m1/s1 |
| InChIKey | ZXWNPSZTUUVCHU-WABSSEDKSA-N |
| XLogP | 1.17 |
| TPSA | 235.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|