C10H12ClN4O8P — CID 87585586
[[(2S,3S,4R,5R)-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate (PubChem CID 87585586) has the molecular formula C10H12ClN4O8P and a molecular weight of 382.65 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87585586 |
| Molecular Formula | C10H12ClN4O8P |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(O)[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H12ClN4O8P/c11-7-3-8(13-1-12-7)15(2-14-3)9-5(17)4(16)6(22-9)10(18)23-24(19,20)21/h1-2,4-6,9-10,16-18H,(H2,19,20,21)/t4-,5+,6-,9+,10?/m0/s1 |
| InChIKey | VNSBGMCJCADANX-YLXOIZHRSA-N |
| XLogP | -1.47 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|