C13H20N5O8PS — CID 123591296
[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(propylamino)purin-9-yl]oxolan-2-yl]-hydroxymethyl]sulfanyl dihydrogen phosphate (PubChem CID 123591296) has the molecular formula C13H20N5O8PS and a molecular weight of 437.37 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(propylamino)purin-9-yl]oxolan-2-yl]-hydroxymethyl]sulfanyl dihydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(propylamino)purin-9-yl]oxolan-2-yl]-hydroxymethyl]sulfanyl dihydrogen phosphate |
|---|---|
| PubChem CID | 123591296 |
| Molecular Formula | C13H20N5O8PS |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(propylamino)purin-9-yl]oxolan-2-yl]-hydroxymethyl]sulfanyl dihydrogen phosphate |
| SMILES | CCCNc1ncnc2c1ncn2[C@@H]1O[C@H](C(O)SOP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N5O8PS/c1-2-3-14-10-6-11(16-4-15-10)18(5-17-6)12-8(20)7(19)9(25-12)13(21)28-26-27(22,23)24/h4-5,7-9,12-13,19-21H,2-3H2,1H3,(H,14,15,16)(H2,22,23,24)/t7-,8+,9-,12+,13?/m0/s1 |
| InChIKey | ZEXDCDWNVWZFRT-XWUUDUPGSA-N |
| XLogP | -0.66 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|