C20H25N6O5P — CID 143911841
[5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate (PubChem CID 143911841) has the molecular formula C20H25N6O5P and a molecular weight of 460.43 g/mol. Its IUPAC name is [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate.
| Compound Name | [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 143911841 |
| Molecular Formula | C20H25N6O5P |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
| SMILES | CC1CC(COP(=O)(O)Oc2ccccc2)OC1n1cnc2c(N3CCC3)nc(N)nc21 |
| InChI | InChI=1S/C20H25N6O5P/c1-13-10-15(11-29-32(27,28)31-14-6-3-2-4-7-14)30-19(13)26-12-22-16-17(25-8-5-9-25)23-20(21)24-18(16)26/h2-4,6-7,12-13,15,19H,5,8-11H2,1H3,(H,27,28)(H2,21,23,24) |
| InChIKey | WEVVLJXIGJUMQA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|