C20H35N8O3P — CID 71585041
9-[(2S,5R)-5-[bis(propan-2-ylamino)phosphoryloxymethyl]oxolan-2-yl]-6-pyrrolidin-1-ylpurin-2-amine (PubChem CID 71585041) has the molecular formula C20H35N8O3P and a molecular weight of 466.53 g/mol. Its IUPAC name is 9-[(2S,5R)-5-[bis(propan-2-ylamino)phosphoryloxymethyl]oxolan-2-yl]-6-pyrrolidin-1-ylpurin-2-amine.
| Compound Name | 9-[(2S,5R)-5-[bis(propan-2-ylamino)phosphoryloxymethyl]oxolan-2-yl]-6-pyrrolidin-1-ylpurin-2-amine |
|---|---|
| PubChem CID | 71585041 |
| Molecular Formula | C20H35N8O3P |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 9-[(2S,5R)-5-[bis(propan-2-ylamino)phosphoryloxymethyl]oxolan-2-yl]-6-pyrrolidin-1-ylpurin-2-amine |
| SMILES | CC(C)NP(=O)(NC(C)C)OC[C@H]1CC[C@@H](n2cnc3c(N4CCCC4)nc(N)nc32)O1 |
| InChI | InChI=1S/C20H35N8O3P/c1-13(2)25-32(29,26-14(3)4)30-11-15-7-8-16(31-15)28-12-22-17-18(27-9-5-6-10-27)23-20(21)24-19(17)28/h12-16H,5-11H2,1-4H3,(H2,21,23,24)(H2,25,26,29)/t15-,16+/m1/s1 |
| InChIKey | IBTYLEDNCAIPIU-CVEARBPZSA-N |
| XLogP | 2.81 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|