C24H30N3O7PS — CID 123991913
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate (PubChem CID 123991913) has the molecular formula C24H30N3O7PS and a molecular weight of 535.56 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate |
|---|---|
| PubChem CID | 123991913 |
| Molecular Formula | C24H30N3O7PS |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate |
| SMILES | C#CC1CC(COP(=S)(NC(CC)C(=O)OC(C)C)Oc2ccccc2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C24H30N3O7PS/c1-5-17-14-19(33-22(17)27-13-12-21(28)25-24(27)30)15-31-35(36,34-18-10-8-7-9-11-18)26-20(6-2)23(29)32-16(3)4/h1,7-13,16-17,19-20,22H,6,14-15H2,2-4H3,(H,26,36)(H,25,28,30) |
| InChIKey | SVWJTFYFHDRBFH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|