C25H32N3O7PS2 — CID 123900499
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-3-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylsulfanylbutanoate (PubChem CID 123900499) has the molecular formula C25H32N3O7PS2 and a molecular weight of 581.65 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-3-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-3-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 123900499 |
| Molecular Formula | C25H32N3O7PS2 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-3-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylsulfanylbutanoate |
| SMILES | C#CC1CC(n2ccc(=O)[nH]c2=O)OC1COP(=S)(NC(CCSC)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C25H32N3O7PS2/c1-5-18-15-23(28-13-11-22(29)26-25(28)31)34-21(18)16-32-36(37,35-19-9-7-6-8-10-19)27-20(12-14-38-4)24(30)33-17(2)3/h1,6-11,13,17-18,20-21,23H,12,14-16H2,2-4H3,(H,27,37)(H,26,29,31) |
| InChIKey | WIKWVZRLKAATQJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|