C24H33FN3O9PS — CID 134135771
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate (PubChem CID 134135771) has the molecular formula C24H33FN3O9PS and a molecular weight of 589.58 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 134135771 |
| Molecular Formula | C24H33FN3O9PS |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](C)(F)[C@@H]1O)Oc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C24H33FN3O9PS/c1-15(2)35-21(31)17(11-13-39-4)27-38(33,37-16-8-6-5-7-9-16)34-14-18-20(30)24(3,25)22(36-18)28-12-10-19(29)26-23(28)32/h5-10,12,15,17-18,20,22,30H,11,13-14H2,1-4H3,(H,27,33)(H,26,29,32)/t17-,18+,20+,22+,24-,38?/m0/s1 |
| InChIKey | CBESXCMIHYCUGY-BQOCLACUSA-N |
| XLogP | 2.39 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|