C24H32N7O7P — CID 174102020
ethyl (2R)-2-[[[(2R,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174102020) has the molecular formula C24H32N7O7P and a molecular weight of 561.54 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174102020 |
| Molecular Formula | C24H32N7O7P |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethenyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@H]1[C@H](O)[C@@H](CO[P@](=O)(N[C@H](C)C(=O)OCC)Oc2ccccc2)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C24H32N7O7P/c1-5-16-19(32)17(37-22(16)31-13-27-18-20(26-4)28-24(25)29-21(18)31)12-36-39(34,30-14(3)23(33)35-6-2)38-15-10-8-7-9-11-15/h5,7-11,13-14,16-17,19,22,32H,1,6,12H2,2-4H3,(H,30,34)(H3,25,26,28,29)/t14-,16+,17-,19+,22-,39-/m1/s1 |
| InChIKey | SLDJZLNHBGCGEQ-MRGVGMHSSA-N |
| XLogP | 2.26 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|