C13H15N5O2 — CID 156801966
6-ethenyl-9-[(1R,4S)-4-(hydroperoxymethyl)cyclopent-2-en-1-yl]purin-2-amine (PubChem CID 156801966) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-ethenyl-9-[(1R,4S)-4-(hydroperoxymethyl)cyclopent-2-en-1-yl]purin-2-amine.
| Compound Name | 6-ethenyl-9-[(1R,4S)-4-(hydroperoxymethyl)cyclopent-2-en-1-yl]purin-2-amine |
|---|---|
| PubChem CID | 156801966 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 6-ethenyl-9-[(1R,4S)-4-(hydroperoxymethyl)cyclopent-2-en-1-yl]purin-2-amine |
| SMILES | C=Cc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](COO)C1 |
| InChI | InChI=1S/C13H15N5O2/c1-2-10-11-12(17-13(14)16-10)18(7-15-11)9-4-3-8(5-9)6-20-19/h2-4,7-9,19H,1,5-6H2,(H2,14,16,17)/t8-,9+/m1/s1 |
| InChIKey | IKWCNQOAUNIBKU-BDAKNGLRSA-N |
| XLogP | 1.66 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|