C14H18N4O2 — CID 10731041
[(1S,4R)-4-(6-propoxypurin-9-yl)cyclopent-2-en-1-yl]methanol (PubChem CID 10731041) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(1S,4R)-4-(6-propoxypurin-9-yl)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1S,4R)-4-(6-propoxypurin-9-yl)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 10731041 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(1S,4R)-4-(6-propoxypurin-9-yl)cyclopent-2-en-1-yl]methanol |
| SMILES | CCCOc1ncnc2c1ncn2[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C14H18N4O2/c1-2-5-20-14-12-13(15-8-16-14)18(9-17-12)11-4-3-10(6-11)7-19/h3-4,8-11,19H,2,5-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | ZGDOIBYFLMJITN-MNOVXSKESA-N |
| XLogP | 1.72 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|