C11H13N5O2 — CID 54351803
1-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-one (PubChem CID 54351803) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-one.
| Compound Name | 1-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-one |
|---|---|
| PubChem CID | 54351803 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]purin-6-one |
| SMILES | Nn1cnc2c(ncn2[C@H]2C=C[C@@H](CO)C2)c1=O |
| InChI | InChI=1S/C11H13N5O2/c12-16-6-14-10-9(11(16)18)13-5-15(10)8-2-1-7(3-8)4-17/h1-2,5-8,17H,3-4,12H2/t7-,8+/m1/s1 |
| InChIKey | UGHATPPZGKVJHK-SFYZADRCSA-N |
| XLogP | -0.58 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|