C14H17N5O3 — CID 170342623
(1R,2S,3R,7R,7aR)-3-(6-aminopurin-9-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,2,7-triol (PubChem CID 170342623) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is (1R,2S,3R,7R,7aR)-3-(6-aminopurin-9-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,2,7-triol.
| Compound Name | (1R,2S,3R,7R,7aR)-3-(6-aminopurin-9-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,2,7-triol |
|---|---|
| PubChem CID | 170342623 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1R,2S,3R,7R,7aR)-3-(6-aminopurin-9-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,2,7-triol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C2=CCC[C@@H](O)[C@@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17N5O3/c15-13-9-14(17-4-16-13)19(5-18-9)10-6-2-1-3-7(20)8(6)11(21)12(10)22/h2,4-5,7-8,10-12,20-22H,1,3H2,(H2,15,16,17)/t7-,8-,10-,11-,12+/m1/s1 |
| InChIKey | GKDHKNGHUVMHGY-WOTQDWCVSA-N |
| XLogP | -0.62 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|