C19H23N5O5S — CID 90934742
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[6-(2-phenylethyl)purin-9-yl]cyclopentyl]-methylsulfamic acid (PubChem CID 90934742) has the molecular formula C19H23N5O5S and a molecular weight of 433.49 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[6-(2-phenylethyl)purin-9-yl]cyclopentyl]-methylsulfamic acid.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[6-(2-phenylethyl)purin-9-yl]cyclopentyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 90934742 |
| Molecular Formula | C19H23N5O5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[6-(2-phenylethyl)purin-9-yl]cyclopentyl]-methylsulfamic acid |
| SMILES | CN([C@@H]1C[C@@H](n2cnc3c(CCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)S(=O)(=O)O |
| InChI | InChI=1S/C19H23N5O5S/c1-23(30(27,28)29)14-9-15(18(26)17(14)25)24-11-22-16-13(20-10-21-19(16)24)8-7-12-5-3-2-4-6-12/h2-6,10-11,14-15,17-18,25-26H,7-9H2,1H3,(H,27,28,29)/t14-,15-,17-,18+/m1/s1 |
| InChIKey | ZKVHSGLCOSNETJ-AHCXZYCDSA-N |
| XLogP | 0.38 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|