C18H21ClN6O4 — CID 11316123
2-[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-tert-butyl-1,3,4-oxadiazole (PubChem CID 11316123) has the molecular formula C18H21ClN6O4 and a molecular weight of 420.86 g/mol. Its IUPAC name is 2-[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-tert-butyl-1,3,4-oxadiazole.
| Compound Name | 2-[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-tert-butyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 11316123 |
| Molecular Formula | C18H21ClN6O4 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-tert-butyl-1,3,4-oxadiazole |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](c1nnc(C(C)(C)C)o1)O[C@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C18H21ClN6O4/c1-17(2,3)16-24-23-14(27-16)10-9-11(29-18(4,5)28-9)15(26-10)25-7-22-8-12(19)20-6-21-13(8)25/h6-7,9-11,15H,1-5H3/t9-,10+,11-,15-/m1/s1 |
| InChIKey | XHPXPUVAPIUKIX-JNIYBQFBSA-N |
| XLogP | 2.95 |
| TPSA | 110.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |