C17H18ClN5O3S2 — CID 87303040
2-[[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-4-methyl-1,3-thiazole (PubChem CID 87303040) has the molecular formula C17H18ClN5O3S2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 2-[[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 87303040 |
| Molecular Formula | C17H18ClN5O3S2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-[[(3aR,4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(SC[C@H]2O[C@@H](n3cnc4c(Cl)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)n1 |
| InChI | InChI=1S/C17H18ClN5O3S2/c1-8-4-27-16(22-8)28-5-9-11-12(26-17(2,3)25-11)15(24-9)23-7-21-10-13(18)19-6-20-14(10)23/h4,6-7,9,11-12,15H,5H2,1-3H3/t9-,11-,12-,15-/m1/s1 |
| InChIKey | JYMOPKCNYSGXMK-SDBHATRESA-N |
| XLogP | 3.45 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |