C17H18ClN5O4 — CID 18336843
2-[(4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-ethyl-1,3-oxazole (PubChem CID 18336843) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is 2-[(4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-ethyl-1,3-oxazole.
| Compound Name | 2-[(4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-ethyl-1,3-oxazole |
|---|---|
| PubChem CID | 18336843 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[(4R,6S,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-ethyl-1,3-oxazole |
| SMILES | CCc1cnc([C@H]2O[C@@H](n3cnc4c(Cl)ncnc43)C3OC(C)(C)O[C@@H]32)o1 |
| InChI | InChI=1S/C17H18ClN5O4/c1-4-8-5-19-15(24-8)11-10-12(27-17(2,3)26-10)16(25-11)23-7-22-9-13(18)20-6-21-14(9)23/h5-7,10-12,16H,4H2,1-3H3/t10-,11+,12?,16-/m1/s1 |
| InChIKey | PIKDIUVQGKHAMH-VILUFWDLSA-N |
| XLogP | 2.82 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |