C16H21ClN4O3 — CID 70685248
2-[2-[[(1R,2S,4R,5S)-5-(6-chloropurin-9-yl)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]ethanol (PubChem CID 70685248) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is 2-[2-[[(1R,2S,4R,5S)-5-(6-chloropurin-9-yl)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[(1R,2S,4R,5S)-5-(6-chloropurin-9-yl)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 70685248 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[2-[[(1R,2S,4R,5S)-5-(6-chloropurin-9-yl)-2-bicyclo[2.2.1]heptanyl]oxy]ethoxy]ethanol |
| SMILES | OCCOCCO[C@H]1C[C@H]2C[C@@H]1C[C@@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C16H21ClN4O3/c17-15-14-16(19-8-18-15)21(9-20-14)12-6-11-5-10(12)7-13(11)24-4-3-23-2-1-22/h8-13,22H,1-7H2/t10-,11-,12+,13+/m1/s1 |
| InChIKey | WLRDTMDQWCBHDB-NDBYEHHHSA-N |
| XLogP | 1.84 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|