C18H27N7O — CID 145364999
9-[5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolan-2-yl]purin-6-amine (PubChem CID 145364999) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 9-[5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 145364999 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 9-[5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CCC(CN2CCCC23CCNCC3)O1 |
| InChI | InChI=1S/C18H27N7O/c19-16-15-17(22-11-21-16)25(12-23-15)14-3-2-13(26-14)10-24-9-1-4-18(24)5-7-20-8-6-18/h11-14,20H,1-10H2,(H2,19,21,22) |
| InChIKey | BRFRKMDHIKXNRI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |