C19H29N7O3 — CID 130418744
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol (PubChem CID 130418744) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130418744 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]oxolane-3,4-diol |
| SMILES | CN1CCC2(CCCN2C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H29N7O3/c1-24-7-4-19(5-8-24)3-2-6-25(19)9-12-14(27)15(28)18(29-12)26-11-23-13-16(20)21-10-22-17(13)26/h10-12,14-15,18,27-28H,2-9H2,1H3,(H2,20,21,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | FLWWAKLSXWUWPW-SCFUHWHPSA-N |
| XLogP | -0.41 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |