C22H32ClN7O3 — CID 155769066
9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-chloropurin-6-amine (PubChem CID 155769066) has the molecular formula C22H32ClN7O3 and a molecular weight of 478.00 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-chloropurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-chloropurin-6-amine |
|---|---|
| PubChem CID | 155769066 |
| Molecular Formula | C22H32ClN7O3 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[(8-methyl-1,8-diazaspiro[4.5]decan-1-yl)methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-chloropurin-6-amine |
| SMILES | CN1CCC2(CCCN2C[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@@H]3OC(C)(C)O[C@@H]32)CC1 |
| InChI | InChI=1S/C22H32ClN7O3/c1-21(2)32-15-13(11-29-8-4-5-22(29)6-9-28(3)10-7-22)31-19(16(15)33-21)30-12-25-14-17(24)26-20(23)27-18(14)30/h12-13,15-16,19H,4-11H2,1-3H3,(H2,24,26,27)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | DXSNKIUFARUXMG-NVQRDWNXSA-N |
| XLogP | 2.04 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |