C11H12N6O3 — CID 137100612
5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 137100612) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | 5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 137100612 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#CC1(CO)CCC(n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C11H12N6O3/c12-3-11(4-18)2-1-6(20-11)17-5-14-7-8(17)15-10(13)16-9(7)19/h5-6,18H,1-2,4H2,(H3,13,15,16,19) |
| InChIKey | SPDUGWQHXKUZFH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |