C14H19N5O2 — CID 136803292
9-[(2S,3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-2-amino-1H-purin-6-one (PubChem CID 136803292) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 9-[(2S,3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(2S,3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 136803292 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 9-[(2S,3aS,6aS)-6a-(hydroxymethyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-2-amino-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@@H]3CCC[C@]3(CO)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N5O2/c15-13-17-11-10(12(21)18-13)16-7-19(11)9-4-8-2-1-3-14(8,5-9)6-20/h7-9,20H,1-6H2,(H3,15,17,18,21)/t8-,9-,14+/m0/s1 |
| InChIKey | JWQOHOZYUJENIP-UINNMSKDSA-N |
| XLogP | 0.82 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |