C13H17N5O4S — CID 136916128
2-amino-9-[(2R,3R,4S,5S,9S)-3,4,9-trihydroxy-1-thiaspiro[4.4]nonan-2-yl]-1H-purin-6-one (PubChem CID 136916128) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S,9S)-3,4,9-trihydroxy-1-thiaspiro[4.4]nonan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S,9S)-3,4,9-trihydroxy-1-thiaspiro[4.4]nonan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136916128 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S,9S)-3,4,9-trihydroxy-1-thiaspiro[4.4]nonan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2S[C@]3(CCC[C@@H]3O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N5O4S/c14-12-16-9-6(10(22)17-12)15-4-18(9)11-7(20)8(21)13(23-11)3-1-2-5(13)19/h4-5,7-8,11,19-21H,1-3H2,(H3,14,16,17,22)/t5-,7+,8-,11+,13-/m0/s1 |
| InChIKey | IFMDZYROLOQQHP-SDUHLABQSA-N |
| XLogP | -1.05 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |